3-Methylphenylacetic acid
- Product Name3-Methylphenylacetic acid
- CAS621-36-3
- MFC9H10O2
- MW150.17
- EINECS210-683-9
- MOL File621-36-3.mol
Chemical Properties
| Melting point | 64-66 °C(lit.) |
| Boiling point | 231.72°C (rough estimate) |
| Density | 1.0858 (rough estimate) |
| refractive index | 1.5002 (estimate) |
| pka | 4.30±0.10(Predicted) |
| form | Shiny Flakes and Chunks |
| color | Colorless to off-white |
| Water Solubility | Soluble in water. |
| BRN | 2043549 |
| InChI | InChI=1S/C9H10O2/c1-7-3-2-4-8(5-7)6-9(10)11/h2-5H,6H2,1H3,(H,10,11) |
| InChIKey | GJMPSRSMBJLKKB-UHFFFAOYSA-N |
| SMILES | C1(CC(O)=O)=CC=CC(C)=C1 |
| CAS DataBase Reference | 621-36-3(CAS DataBase Reference) |
| NIST Chemistry Reference | m-Tolylacetic acid(621-36-3) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29163900 |
