Bis(3,5-dimethylphenyl)chlorophosphine
- Product NameBis(3,5-dimethylphenyl)chlorophosphine
- CAS74289-57-9
- MFC16H18ClP
- MW276.74
- EINECS636-136-8
- MOL File74289-57-9.mol
Chemical Properties
| Boiling point | 115-135 °C(Press: 0.015 Torr) |
| Density | 1.102 g/mL at 25 °C |
| refractive index | n20/D 1.606 |
| Flash point | 110 °C |
| storage temp. | 2-8°C, protect from light, stored under nitrogen |
| form | liquid |
| Appearance | Colorless to light yellow Liquid |
| Water Solubility | Reacts with water. |
| Sensitive | Moisture Sensitive |
| InChI | 1S/C16H18ClP/c1-11-5-12(2)8-15(7-11)18(17)16-9-13(3)6-14(4)10-16/h5-10H,1-4H3 |
| InChIKey | FCEBDAANWYNQMO-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)cc(c1)P(Cl)c2cc(C)cc(C)c2 |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-43-45 |
| RIDADR | UN3261 |
| WGK Germany | 3 |
| HazardClass | 8 |
| PackingGroup | II |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |