| Melting point |
191-192 °C |
| Boiling point |
515.4±50.0 °C(Predicted) |
| Density |
1.503±0.06 g/cm3(Predicted) |
| refractive index |
-75 ° (C=1, EtOH) |
| storage temp. |
Sealed in dry,2-8°C |
| solubility |
ethanol: soluble 25 mg/mL, clear, colorless to faintly yellow |
| form |
powder to crystal |
| pka |
12.68±0.70(Predicted) |
| color |
White to Almost white |
| BRN |
1291394 |
| InChI |
1S/C12H15NO7/c1-6-9(14)10(15)11(16)12(19-6)20-8-4-2-7(3-5-8)13(17)18/h2-6,9-12,14-16H,1H3/t6-,9+,10+,11-,12+/m1/s1 |
| InChIKey |
YILIDCGSXCGACV-BVWHHUJWSA-N |
| SMILES |
C[C@H]1O[C@@H](Oc2ccc(cc2)[N+]([O-])=O)[C@H](O)[C@@H](O)[C@H]1O |
| CAS DataBase Reference |
1226-39-7(CAS DataBase Reference) |
