3,3',5,5'-Tetramethylbiphenyl
- Product Name3,3',5,5'-Tetramethylbiphenyl
- CAS25570-02-9
- MFC16H18
- MW210.31
- EINECS
- MOL File25570-02-9.mol
Chemical Properties
| Melting point | 47-49°C |
| Boiling point | 110 °C(Press: 0.4 Torr) |
| Density | 0.956±0.06 g/cm3(Predicted) |
| storage temp. | Store at room temperature |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 1935931 |
| InChI | 1S/C16H18/c1-11-5-12(2)8-15(7-11)16-9-13(3)6-14(4)10-16/h5-10H,1-4H3 |
| InChIKey | CMZYGFLOKOQMKF-UHFFFAOYSA-N |
| SMILES | Cc1cc(cc(c1)c2cc(cc(c2)C)C)C |
Safety Information
| Hazard Codes | Xn,N |
| Risk Statements | 22-50/53 |
| Safety Statements | 22-24/25-61-60 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 2 |
| HS Code | 2902.90.9000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 |
