(S)-2-Methylproline
- Product Name(S)-2-Methylproline
- CAS42856-71-3
- MFC6H11NO2
- MW129.16
- EINECS610-068-9
- MOL File42856-71-3.mol
Chemical Properties
| Melting point | 310°C(lit.) |
| Boiling point | 241.9±33.0 °C(Predicted) |
| Density | 1.119±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 2.44±0.20(Predicted) |
| color | White to Almost white |
| BRN | 4350211 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C6H11NO2/c1-6(5(8)9)3-2-4-7-6/h7H,2-4H2,1H3,(H,8,9)/t6-/m0/s1 |
| InChIKey | LWHHAVWYGIBIEU-LURJTMIESA-N |
| SMILES | C(O)(=O)[C@]1(C)CCCN1 |
| CAS DataBase Reference | 42856-71-3(CAS DataBase Reference) |
Safety Information
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29339900 |
| Storage Class | 11 - Combustible Solids |
