2-Isonitrosoacetophenone
- Product Name2-Isonitrosoacetophenone
- CAS532-54-7
- MFC8H7NO2
- MW149.15
- EINECS208-539-5
- MOL File532-54-7.mol
Chemical Properties
| Melting point | 126-128 °C (lit.) |
| Boiling point | 270.21°C (rough estimate) |
| Density | 1.2517 (rough estimate) |
| refractive index | 1.5320 (estimate) |
| storage temp. | 2-8°C |
| form | powder to crystal |
| pka | 8.49±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| Water Solubility | SOLUBLE IN COLD WATER |
| Merck | 14,5191 |
| BRN | 2041691 |
| InChI | InChI=1S/C8H7NO2/c10-8(6-9-11)7-4-2-1-3-5-7/h1-6,11H/b9-6+ |
| InChIKey | MLNKXLRYCLKJSS-RMKNXTFCSA-N |
| SMILES | C1(C=CC=CC=1)C(=O)/C=N/O |
| CAS DataBase Reference | 532-54-7(CAS DataBase Reference) |
| EPA Substance Registry System | Isonitrosoacetophenone (532-54-7) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 36/37-24/25 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | MD3325000 |
| TSCA | TSCA listed |
| HS Code | 2922390090 |
| Storage Class | 11 - Combustible Solids |
