| Melting point |
67-71 °C |
| Boiling point |
379.74°C (rough estimate) |
| Density |
1.3350 (rough estimate) |
| refractive index |
1.5300 (estimate) |
| storage temp. |
Sealed in dry,Room Temperature |
| pka |
8.70±0.25(Predicted) |
| form |
powder to crystal |
| color |
White to Light yellow to Light orange |
| BRN |
1124763 |
| InChI |
InChI=1S/C11H11NO5/c1-2-17-11(14)7-10(13)8-3-5-9(6-4-8)12(15)16/h3-6H,2,7H2,1H3 |
| InChIKey |
NGRXSVFCLHVGKU-UHFFFAOYSA-N |
| SMILES |
C1(C=CC([N+]([O-])=O)=CC=1)C(=O)CC(=O)OCC |
| CAS DataBase Reference |
838-57-3(CAS DataBase Reference) |
| EPA Substance Registry System |
Benzenepropanoic acid, 4-nitro-.beta.-oxo-, ethyl ester (838-57-3) |
