N-Octyltrimethylammonium bromide
- Product NameN-Octyltrimethylammonium bromide
- CAS2083-68-3
- MFC11H26BrN
- MW252.23
- EINECS
- MOL File2083-68-3.mol
Chemical Properties
| Melting point | 220-222°C |
| Boiling point | 114 °C(Press: 5 Torr) |
| storage temp. | Inert atmosphere,Room Temperature |
| Water Solubility | Soluble in water |
| form | powder to lump |
| color | White to Almost white |
| Sensitive | Hygroscopic |
| BRN | 3628448 |
| InChI | 1S/C11H26N.BrH/c1-5-6-7-8-9-10-11-12(2,3)4;/h5-11H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | XCOHAFVJQZPUKF-UHFFFAOYSA-M |
| SMILES | [Br-].CCCCCCCC[N+](C)(C)C |
| CAS DataBase Reference | 2083-68-3(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Octanaminium, N,N,N-trimethyl-, bromide (2083-68-3) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| RTECS | RG8275000 |
| HS Code | 29239000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |