| Melting point |
-31 °C (lit.) |
| Boiling point |
183 °C (lit.) |
| Density |
0.88 g/mL at 25 °C (lit.) |
| refractive index |
n20/D 1.502(lit.) |
| Flash point |
121 °F |
| solubility |
soluble in DMSO, Methanol |
| form |
Oil |
| color |
Clear Colorless |
| Odor Threshold |
0.0094ppm |
| Water Solubility |
Miscible with alcohol, benzene and carbon tetrachloride. Immiscible with water. |
| Thermal Conductivity |
0.133 W/(m·K) at 25 ℃ |
| BRN |
1904392 |
| Henry's Law Constant |
3.8×10-3 mol/(m3Pa) at 25℃, Duchowicz et al. (2020) |
| InChI |
InChI=1S/C10H14/c1-3-9-7-5-6-8-10(9)4-2/h5-8H,3-4H2,1-2H3 |
| InChIKey |
KVNYFPKFSJIPBJ-UHFFFAOYSA-N |
| SMILES |
C1(CC)=CC=CC=C1CC |
| LogP |
3.720 |
| CAS DataBase Reference |
135-01-3(CAS DataBase Reference) |
| EPA Substance Registry System |
o-Diethylbenzene (135-01-3) |
