3,4-Dihydroisoquinoline
- Product Name3,4-Dihydroisoquinoline
- CAS3230-65-7
- MFC9H9N
- MW131.17
- EINECS221-769-0
- MOL File3230-65-7.mol
Chemical Properties
| Melting point | 251-254℃ |
| Boiling point | 241.8±20.0℃ (760 Torr) |
| Density | 1.05±0.1 g/cm3 (20 ºC 760 Torr) |
| refractive index | 1.6041 (589.3 nm 30℃) |
| Flash point | 91.6±22.6℃ |
| storage temp. | 2-8°C |
| form | solid |
| pka | 5.80±0.20(Predicted) |
| Appearance | White to off-white Solid |
| InChI | InChI=1S/C9H9N/c1-2-4-9-7-10-6-5-8(9)3-1/h1-4,7H,5-6H2 |
| InChIKey | NKSZCPBUWGZONP-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2)CCN=1 |
Safety Information
| Hazard Codes | T |
| Risk Statements | 22-24-36/38 |
| Safety Statements | 26-36/37-45 |
| RIDADR | UN 2811 6.1 / PGII |
| WGK Germany | 3 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Dermal Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 |
