4-(Phenylazo)benzoic acid
- Product Name4-(Phenylazo)benzoic acid
- CAS1562-93-2
- MFC13H10N2O2
- MW226.23
- EINECS216-347-8
- MOL File1562-93-2.mol
Chemical Properties
| Melting point | 247-250 °C(lit.) |
| Boiling point | 418.1±28.0 °C(Predicted) |
| Density | 1.19±0.1 g/cm3(Predicted) |
| storage temp. | Store at -20°C |
| pka | 3.81±0.10(Predicted) |
| form | powder to crystal |
| color | Orange to Brown |
| InChI | 1S/C13H10N2O2/c16-13(17)10-6-8-12(9-7-10)15-14-11-4-2-1-3-5-11/h1-9H,(H,16,17)/b15-14+ |
| InChIKey | CSPTZWQFHBVOLO-CCEZHUSRSA-N |
| SMILES | OC(=O)c1ccc(cc1)\N=N\c2ccccc2 |
| EPA Substance Registry System | Benzoic acid, 4-(phenylazo)- (1562-93-2) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29270000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
