| Melting point |
178-182 °C |
| Boiling point |
64.7 °C |
| Density |
0.791 |
| bulk density |
360kg/m3 |
| Flash point |
12 °C |
| storage temp. |
Store at +5°C to +30°C. |
| solubility |
H2O: soluble |
| Colour Index |
13020 |
| pka |
2.3, 5.0(at 25℃) |
| form |
Solid |
| color |
White to yellow or beige, darkening on exposure to light |
| Odor |
Odorless |
| PH Range |
Red (1.2) to orange (3.4);Red (4.2) to yellow (6.3) |
| PH |
8.2 (10g/l, H2O, 25℃) |
| Water Solubility |
Soluble in water. Slightly soluble in ethanol. |
| λmax |
437nm, 410nm, 493nm |
| BRN |
4065488 |
| Stability |
Reported to be unstable, but this is probably a mistake on a commercial MSDS sheet. Incompatible with strong oxidizing agents. |
| Major Application |
optical fibers, liquid crystal cells, holography, inks, toner, corrosion inhibitor, detergent |
| InChI |
1S/C15H15N3O2.Na/c1-18(2)12-9-7-11(8-10-12)16-17-14-6-4-3-5-13(14)15(19)20;/h3-10H,1-2H3,(H,19,20);/q;+1/p-1/b17-16+; |
| InChIKey |
GNTPCYMJCJNRQB-CMBBICFISA-M |
| SMILES |
[Na+].CN(C)c1ccc(cc1)\N=N\c2ccccc2C([O-])=O |
| CAS DataBase Reference |
845-10-3(CAS DataBase Reference) |
| EPA Substance Registry System |
Benzoic acid, 2-[[4-(dimethylamino)phenyl]azo]-, sodium salt (845-10-3) |
