N-Fmoc-N'-Boc-L-2,3-Diaminopropionic acid
- Product NameN-Fmoc-N'-Boc-L-2,3-Diaminopropionic acid
- CAS162558-25-0
- MFC23H26N2O6
- MW426.46
- EINECS2017-001-1
- MOL File162558-25-0.mol
Chemical Properties
| Melting point | 131-139 .°C |
| Boiling point | 652.5±55.0 °C(Predicted) |
| Density | 1.263±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | powder to crystal |
| pka | 3.58±0.10(Predicted) |
| color | White to Almost white |
| Water Solubility | Slightly soluble in water. |
| BRN | 7057792 |
| Major Application | peptide synthesis |
| InChIKey | PKAUMAVONPSDRW-IBGZPJMESA-N |
| SMILES | C(O)(=O)[C@H](CNC(OC(C)(C)C)=O)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| CAS DataBase Reference | 162558-25-0(CAS DataBase Reference) |
Safety Information
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 2924 29 70 |
| HazardClass | IRRITANT |
| Storage Class | 11 - Combustible Solids |