2-Dodecen-1-ylsuccinic anhydride
- Product Name2-Dodecen-1-ylsuccinic anhydride
- CAS19780-11-1
- MFC16H26O3
- MW266.38
- EINECS243-296-9
- MOL File19780-11-1.mol
Chemical Properties
| Melting point | 41-43 °C(lit.) |
| Boiling point | 180-182 °C5 mm Hg(lit.) |
| Density | 1.00 g/mL at 20 °C |
| vapor density | 9.2 (vs air) |
| vapor pressure | <1 mm Hg ( 20 °C) |
| refractive index | 1.5400 (estimate) |
| Flash point | 352 °F |
| storage temp. | 2-8°C, protect from light |
| solubility | 5g/L in organic solvents at 20 ℃ |
| form | powder to lump |
| color | White to Orange to Green |
| Water Solubility | 130μg/L at 25℃ |
| Stability | Stable, but moisture-sensitive. Combustible. Incompatible with water. |
| InChI | 1S/C16H26O3/c1-2-3-4-5-6-7-8-9-10-11-12-14-13-15(17)19-16(14)18/h10-11,14H,2-9,12-13H2,1H3/b11-10+ |
| InChIKey | UYCICMIUKYEYEU-ZHACJKMWSA-N |
| SMILES | CCCCCCCCC\C=C/CC1CC(=O)OC1=O |
| LogP | 4.38 at 25℃ |
| CAS DataBase Reference | 19780-11-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | 3077 |
| WGK Germany | 3 |
| RTECS | WN1225000 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 2917198025 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |