ZIRCONIUM(IV) ACETYLACETONATE
- Product NameZIRCONIUM(IV) ACETYLACETONATE
- CAS17501-44-9
- MFC20H28O8Zr
- MW487.66
- EINECS241-510-5
- MOL File17501-44-9.mol
Chemical Properties
| Melting point | 191-195 °C |
| Density | 1.42g/cm3 at 20℃ |
| bulk density | 500kg/m3 |
| vapor pressure | 0-0Pa at 20-25℃ |
| storage temp. | Store below +30°C. |
| solubility | 14g/l |
| form | Powder |
| color | white |
| PH | 7.2 (4.5g/l, H2O, 20℃) |
| Water Solubility | Soluble in water. |
| BRN | 4160373 |
| Exposure limits | ACGIH: TWA 5 mg/m3; STEL 10 mg/m3 NIOSH: IDLH 25 mg/m3; TWA 5 mg/m3; STEL 10 mg/m3 |
| InChI | 1S/4C5H8O2.Zr/c4*1-4(6)3-5(2)7;/h4*3,6H,1-2H3;/q;;;;+4/p-4/b4*4-3-; |
| InChIKey | FPFOSIXCIBGKOH-MTOQALJVSA-J |
| SMILES | CC(=O)\C=C(\C)O[Zr](O\C(C)=C/C(C)=O)(O\C(C)=C/C(C)=O)O\C(C)=C/C(C)=O |
| LogP | 0.12-0.2 at 20℃ and pH7.1 |
| Surface tension | 67.28mN/m at 1g/L and 20℃ |
| EPA Substance Registry System | Zirconium, tetrakis(2,4-pentanedionato-.kappa.O,.kappa.O')-, (SA-8-11''11''1'1'''1'1''')- (17501-44-9) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22-40-36/37/38-20/21/22-63 |
| Safety Statements | 22-24/25-36/37-26-7 |
| WGK Germany | 3 |
| RTECS | ZH9280000 |
| TSCA | TSCA listed |
| HS Code | 2914 19 90 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Flam. Sol. 1 |
| Toxicity | LD50 orally in Rabbit: 719 mg/kg |
