(S)-(+)-1,2,3,4-Tetrahydro-1-naphthol
- Product Name(S)-(+)-1,2,3,4-Tetrahydro-1-naphthol
- CAS53732-47-1
- MFC10H12O
- MW148.2
- EINECS
- MOL File53732-47-1.mol
Chemical Properties
| Melting point | 37-39 °C |
| Boiling point | 92 °C / 1.8mmHg |
| Density | 1.09 g/mL at 25 °C(lit.) |
| refractive index | 33 ° (C=2.5, CHCl3) |
| Flash point | 113 °C |
| solubility | almost transparency in Methanol |
| form | powder to crystal |
| pka | 14.33±0.20(Predicted) |
| color | White to Almost white |
| optical activity | [α]20/D +33±1°, c = 2.5% in chloroform |
| BRN | 2208779 |
| InChI | InChI=1S/C10H12O/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-2,4,6,10-11H,3,5,7H2/t10-/m0/s1 |
| InChIKey | JAAJQSRLGAYGKZ-JTQLQIEISA-N |
| SMILES | [C@@H]1(O)C2=C(C=CC=C2)CCC1 |
| CAS DataBase Reference | 53732-47-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | QL5075000 |
| HS Code | 2907.19.8000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
