4-(Dimethylamino)benzophenone
- Product Name4-(Dimethylamino)benzophenone
- CAS530-44-9
- MFC15H15NO
- MW225.29
- EINECS208-478-4
- MOL File530-44-9.mol
Chemical Properties
| Melting point | 88-90 °C(lit.) |
| Boiling point | 250 °C / 15mmHg |
| Density | 1.0463 (rough estimate) |
| refractive index | 1.5200 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | powder to crystal |
| pka | 2.12±0.12(Predicted) |
| color | White to Light yellow to Green |
| Water Solubility | insoluble |
| Merck | 14,3233 |
| InChI | 1S/C15H15NO/c1-16(2)14-10-8-13(9-11-14)15(17)12-6-4-3-5-7-12/h3-11H,1-2H3 |
| InChIKey | BEUGBYXJXMVRFO-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(cc1)C(=O)c2ccccc2 |
| CAS DataBase Reference | 530-44-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Methanone, [4-(dimethylamino)phenyl]phenyl-(530-44-9) |
| EPA Substance Registry System | Methanone, [4-(dimethylamino)phenyl]phenyl- (530-44-9) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29223900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
