| Melting point |
-63 °C (lit.) |
| Boiling point |
203 °C (lit.) |
| Density |
0.856 g/mL at 25 °C (lit.) |
| vapor pressure |
9.97Pa at 20℃ |
| refractive index |
n20/D 1.488(lit.) |
| Flash point |
170 °F |
| storage temp. |
Store at room temperature, keep dry and cool |
| form |
clear liquid |
| color |
Colorless to Almost colorless |
| Water Solubility |
Soluble in water 4.33 mg/L at 25°C. |
| BRN |
1905828 |
| Henry's Law Constant |
9.5×10-4 mol/(m3Pa) at 25℃, Yaws (2003) |
| InChI |
InChI=1S/C12H18/c1-9(2)11-6-5-7-12(8-11)10(3)4/h5-10H,1-4H3 |
| InChIKey |
UNEATYXSUBPPKP-UHFFFAOYSA-N |
| SMILES |
C1(C(C)C)=CC=CC(C(C)C)=C1 |
| LogP |
5.13 at 25℃ |
| CAS DataBase Reference |
99-62-7(CAS DataBase Reference) |
| EPA Substance Registry System |
m-Diisopropylbenzene (99-62-7) |
