3,5-Di-tert-butylcatechol
- Product Name3,5-Di-tert-butylcatechol
- CAS1020-31-1
- MFC14H22O2
- MW222.32
- EINECS213-816-9
- MOL File1020-31-1.mol
Chemical Properties
| Melting point | 95-100 °C(lit.) |
| Boiling point | 145 °C / 5mmHg |
| Density | 1.0200 (rough estimate) |
| refractive index | 1.4576 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | 10.04±0.15(Predicted) |
| form | Solid |
| color | White to pale brown |
| Water Solubility | Insoluble in water. |
| BRN | 1370212 |
| Stability | Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C14H22O2/c1-13(2,3)9-7-10(14(4,5)6)12(16)11(15)8-9/h7-8,15-16H,1-6H3 |
| InChIKey | PJZLSMMERMMQBJ-UHFFFAOYSA-N |
| SMILES | C1(O)=CC(C(C)(C)C)=CC(C(C)(C)C)=C1O |
| CAS DataBase Reference | 1020-31-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,2-Benzenediol, 3,5-bis(1,1-dimethylethyl)-(1020-31-1) |
| EPA Substance Registry System | 1,2-Benzenediol, 3,5-bis(1,1-dimethylethyl)- (1020-31-1) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| F | 10-23 |
| TSCA | TSCA listed |
| HS Code | 29072900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
