1,3-Diisopropylbenzene
- Product Name1,3-Diisopropylbenzene
- CAS99-62-7
- CBNumberCB8393096
- MFC12H18
- MW162.27
- EINECS202-773-1
- MDL NumberMFCD00008889
- MOL File99-62-7.mol
- MSDS FileSDS
Chemical Properties
| Melting point | -63 °C (lit.) |
| Boiling point | 203 °C (lit.) |
| Density | 0.856 g/mL at 25 °C (lit.) |
| vapor pressure | 9.97Pa at 20℃ |
| refractive index | n |
| Flash point | 170 °F |
| storage temp. | Store at room temperature, keep dry and cool |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Water Solubility | Soluble in water 4.33 mg/L at 25°C. |
| BRN | 1905828 |
| Henry's Law Constant | 9.5×10-4 mol/(m3Pa) at 25℃, Yaws (2003) |
| InChI | InChI=1S/C12H18/c1-9(2)11-6-5-7-12(8-11)10(3)4/h5-10H,1-4H3 |
| InChIKey | UNEATYXSUBPPKP-UHFFFAOYSA-N |
| SMILES | C1(C(C)C)=CC=CC(C(C)C)=C1 |
| LogP | 5.13 at 25℃ |
| CAS DataBase Reference | 99-62-7(CAS DataBase Reference) |
| FDA UNII | 482VXW192E |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H227-H315-H320-H410 | |||||||||
| Precautionary statements | P210-P264-P273-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P370+P378-P391-P403+P235-P501-P210e-P280a-P370+P378a-P501a | |||||||||
| Risk Statements | 33 | |||||||||
| RIDADR | UN 3082 9/PG 3 | |||||||||
| WGK Germany | 2 | |||||||||
| RTECS | CZ6334000 | |||||||||
| Autoignition Temperature | 840 °F | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 2902.90.9000 | |||||||||
| HazardClass | 9 | |||||||||
| PackingGroup | III | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| Hazardous Substances Data | 99-62-7(Hazardous Substances Data) | |||||||||
| NFPA 704: |
|
