9-Aminofluorene hydrochloride
- Product Name9-Aminofluorene hydrochloride
- CAS5978-75-6
- MFC13H12ClN
- MW217.69
- EINECS227-778-6
- MOL File5978-75-6.mol
Chemical Properties
| Melting point | 265-270 °C (dec.)(lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| color | White to Light yellow |
| Sensitive | Hygroscopic |
| BRN | 3915368 |
| InChI | InChI=1S/C13H11N.ClH/c14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13;/h1-8,13H,14H2;1H |
| InChIKey | SYKJOJSYQSVNOM-UHFFFAOYSA-N |
| SMILES | C1(N)C2=C(C=CC=C2)C2=C1C=CC=C2.[H]Cl |
| CAS DataBase Reference | 5978-75-6(CAS DataBase Reference) |
Safety Information
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| RTECS | LL5130000 |
| PackingGroup | III |
| HS Code | 2921490090 |
| Storage Class | 13 - Non Combustible Solids |