9-Fluorenone oxime
- Product Name9-Fluorenone oxime
- CAS2157-52-0
- MFC13H9NO
- MW195.22
- EINECS218-471-8
- MOL File2157-52-0.mol
Chemical Properties
| Melting point | 193-194°C |
| Boiling point | 394.1±15.0 °C(Predicted) |
| Density | 1.23 |
| storage temp. | Inert atmosphere,2-8°C |
| form | powder to crystal |
| pka | 10.81±0.20(Predicted) |
| color | Light orange to Yellow to Green |
| BRN | 1871046 |
| InChI | InChI=1S/C13H9NO/c15-14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8,15H |
| InChIKey | CRNNFEKVPRFZKJ-UHFFFAOYSA-N |
| SMILES | C1(=N/O)\C2=C(C=CC=C2)C2=C\1C=CC=C2 |
| CAS DataBase Reference | 2157-52-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Safety Statements | 22-24/25 |
| RTECS | LL9093000 |
| HS Code | 29221990 |
| Toxicity | mouse,LD50,unreported,560mg/kg (560mg/kg),Pharmaceutical Chemistry Journal Vol. 12, Pg. 227, 1978. |