Chlorodifluoroacetic anhydride
- Product NameChlorodifluoroacetic anhydride
- CAS2834-23-3
- MFC4Cl2F4O3
- MW242.93
- EINECS220-603-4
- MOL File2834-23-3.mol
Chemical Properties
| Boiling point | 96-97 °C (lit.) |
| Density | 1.395 g/mL at 25 °C (lit.) |
| refractive index | 1.347 |
| Flash point | None |
| storage temp. | RT, protect from light, stored under nitrogen |
| form | clear liquid |
| Specific Gravity | 1.395 |
| color | Colorless to Almost colorless |
| Water Solubility | Slightly Soluble in water. (1.4 g/L) (25°C) |
| Sensitive | Lachrymatory |
| BRN | 1912832 |
| InChI | InChI=1S/C4Cl2F4O3/c5-3(7,8)1(11)13-2(12)4(6,9)10 |
| InChIKey | VBJIFLOSOQGDRZ-UHFFFAOYSA-N |
| SMILES | O(C(=O)C(F)(F)Cl)C(=O)C(F)(F)Cl |
| CAS DataBase Reference | 2834-23-3(CAS DataBase Reference) |
| EPA Substance Registry System | Acetic acid, chlorodifluoro-, anhydride (2834-23-3) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 23/24/25-34-21/22 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | 3265 |
| WGK Germany | 3 |
| Hazard Note | Corrosive/Lachrymatory |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 2915907098 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Eye Dam. 1 Skin Corr. 1B |
