1-(4-NITROPHENYLAZO)-2-NAPHTHOL
- Product Name1-(4-NITROPHENYLAZO)-2-NAPHTHOL
- CAS6410-10-2
- MFC16H11N3O3
- MW293.28
- EINECS229-093-8
- MOL File6410-10-2.mol
Chemical Properties
| Melting point | 248-252 °C |
| Boiling point | 435.13°C (rough estimate) |
| Density | 1.2211 (rough estimate) |
| refractive index | 1.6500 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly, Heated) |
| form | solid |
| Colour Index | 12070 |
| pka | 13.45±0.50(Predicted) |
| color | Red |
| λmax | 488 nm |
| BRN | 680469 |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChI | 1S/C16H11N3O3/c20-15-10-5-11-3-1-2-4-14(11)16(15)18-17-12-6-8-13(9-7-12)19(21)22/h1-10,20H |
| InChIKey | WOTPFVNWMLFMFW-UHFFFAOYSA-N |
| SMILES | Oc1ccc2ccccc2c1N=Nc3ccc(cc3)[N+]([O-])=O |
| CAS DataBase Reference | 6410-10-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26-36/37/39 |
| WGK Germany | 3 |
| RTECS | QL4510000 |
| TSCA | TSCA listed |
| HS Code | 29270000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
