4-Bromoisophthalic acid
- Product Name4-Bromoisophthalic acid
- CAS6939-93-1
- MFC8H5BrO4
- MW245.03
- EINECS230-078-3
- MOL File6939-93-1.mol
Chemical Properties
| Melting point | 297-299 °C(lit.) |
| Boiling point | 430.6±40.0 °C(Predicted) |
| Density | 1.8281 (rough estimate) |
| refractive index | 1.4490 (estimate) |
| storage temp. | Store at room temperature |
| solubility | soluble in Methanol |
| pka | 2.48±0.10(Predicted) |
| form | Crystalline Powder and Chunks |
| color | White to off-white |
| BRN | 1959392 |
| InChI | 1S/C8H5BrO4/c9-6-2-1-4(7(10)11)3-5(6)8(12)13/h1-3H,(H,10,11)(H,12,13) |
| InChIKey | MSQIEZXCNYUWHN-UHFFFAOYSA-N |
| SMILES | OC(=O)c1ccc(Br)c(c1)C(O)=O |
| CAS DataBase Reference | 6939-93-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-37 |
| WGK Germany | 3 |
| HS Code | 29173990 |
| Storage Class | 13 - Non Combustible Solids |
