3,5-Dinitrobenzoic acid
- Product Name3,5-Dinitrobenzoic acid
- CAS99-34-3
- MFC7H4N2O6
- MW212.12
- EINECS202-751-1
- MOL File99-34-3.mol
Chemical Properties
| Melting point | 204-206 °C (lit.) |
| Boiling point | 351.93°C (rough estimate) |
| Density | 1.683 |
| refractive index | 1.5300 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | ethanol: soluble0.5g/10 mL, clear, yellow to very deep greenish-yellow |
| form | Solid |
| pka | pK1:2.85 (25°C) |
| color | Yellow crystalline |
| PH Range | 2.7 |
| Water Solubility | 1350 mg/L (25 ºC) |
| Merck | 14,3276 |
| BRN | 1914286 |
| Henry's Law Constant | 8.0×104 mol/(m3Pa) at 25℃, Abraham and Jr. (2019) |
| Stability | Stable. Contact with strong bases may lead to fire. Incompatible with strong bases, strong oxidizing agents. |
| InChI | 1S/C7H4N2O6/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h1-3H,(H,10,11) |
| InChIKey | VYWYYJYRVSBHJQ-UHFFFAOYSA-N |
| SMILES | OC(=O)c1cc(cc(c1)[N+]([O-])=O)[N+]([O-])=O |
Safety Information
| Hazard Codes | Xn,F |
| Risk Statements | 22-36/37/38-68-11 |
| Safety Statements | 26-36/37/39-16 |
| RIDADR | UN1325 |
| WGK Germany | 3 |
| RTECS | DG9140700 |
| TSCA | TSCA listed |
| HazardClass | 4.1 |
| PackingGroup | III |
| HS Code | 29163900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 4 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |