4-Nitrophenyl chloroformate
- Product Name4-Nitrophenyl chloroformate
- CAS7693-46-1
- MFC7H4ClNO4
- MW201.56
- EINECS231-706-9
- MOL File7693-46-1.mol
Chemical Properties
| Melting point | 77-79 °C(lit.) |
| Boiling point | 159-162 °C19 mm Hg(lit.) |
| Density | 1.5719 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| Flash point | >110°C |
| storage temp. | 2-8°C |
| solubility | Soluble in acetone, chloroform, acetone, toluene and benzene. |
| form | isopropanol suspension |
| color | White to yellow-beige |
| Water Solubility | decomposes |
| Sensitive | Lachrymatory |
| BRN | 518127 |
| Stability | Stable. Incompatible with strong bases, acids. Combustible. |
| Major Application | peptide synthesis |
| InChI | 1S/C7H4ClNO4/c8-7(10)13-6-3-1-5(2-4-6)9(11)12/h1-4H |
| InChIKey | NXLNNXIXOYSCMB-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc(OC(Cl)=O)cc1 |
| CAS DataBase Reference | 7693-46-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C,T,Xi,F |
| Risk Statements | 34-36/37-23/24/25-41-36/37/38-11-67-36 |
| Safety Statements | 26-36/37/39-45-38-28A-36-16-27 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| F | 19-21 |
| Hazard Note | Toxic/Corrosive/Lachrymator |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29159020 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B STOT SE 3 |