N,N'-1,3-Phenylene bismaleimide
- Product NameN,N'-1,3-Phenylene bismaleimide
- CAS3006-93-7
- MFC14H8N2O4
- MW268.22
- EINECS221-112-8
- MOL File3006-93-7.mol
Chemical Properties
| Melting point | 198-201 °C(lit.) |
| Boiling point | 411.39°C (rough estimate) |
| Density | 1.3140 (rough estimate) |
| vapor pressure | 0Pa at 25℃ |
| refractive index | 1.5910 (estimate) |
| Flash point | >208℃ |
| storage temp. | Sealed in dry,Room Temperature |
| pka | -1.67±0.20(Predicted) |
| form | powder to crystal |
| color | Light yellow to Brown to Dark green |
| Water Solubility | negligible soluble |
| InChI | InChI=1S/C14H8N2O4/c17-11-4-5-12(18)15(11)9-2-1-3-10(8-9)16-13(19)6-7-14(16)20/h1-8H |
| InChIKey | IPJGAEWUPXWFPL-UHFFFAOYSA-N |
| SMILES | C1(N2C(=O)C=CC2=O)=CC=CC(N2C(=O)C=CC2=O)=C1 |
| LogP | 0.67 at 24℃ |
| CAS DataBase Reference | 3006-93-7(CAS DataBase Reference) |
| EPA Substance Registry System | 1H-Pyrrole-2,5-dione, 1,1'-(1,3-phenylene)bis- (3006-93-7) |
Safety Information
| Hazard Codes | T,Xi,T+ |
| Risk Statements | 23/24/25-36/37/38-26-22 |
| Safety Statements | 27-28-36/37/39-45-38-28A |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | ON6125000 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 38220090 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Inhalation Acute Tox. 4 Oral |
| Toxicity | LD50 oral in rat: 1370mg/kg |
