2-Chloro-5-(trifluoromethyl)phenylboronic acid
- Product Name2-Chloro-5-(trifluoromethyl)phenylboronic acid
- CAS182344-18-9
- MFC7H5BClF3O2
- MW224.37
- EINECS
- MOL File182344-18-9.mol
Chemical Properties
| Melting point | 108 °C |
| Boiling point | 303.2±52.0 °C(Predicted) |
| Density | 1.49±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 7.26±0.58(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C7H5BClF3O2/c9-6-2-1-4(7(10,11)12)3-5(6)8(13)14/h1-3,13-14H |
| InChIKey | YVMXEHZEYONARR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(C(F)(F)F)=CC=C1Cl)(O)O |
| CAS DataBase Reference | 182344-18-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| RIDADR | UN 3335 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29319090 |
