N-Isopropylphthalimide
- Product NameN-Isopropylphthalimide
- CAS304-17-6
- MFC11H11NO2
- MW189.21
- EINECS206-150-5
- MOL File304-17-6.mol
Chemical Properties
| Melting point | 82-84°C |
| Boiling point | 273°C(lit.) |
| Density | 1.1596 (rough estimate) |
| refractive index | 1.5012 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | -2.15±0.20(Predicted) |
| color | White to Almost white |
| Cosmetics Ingredients Functions | SOLVENT PLASTICISER SKIN CONDITIONING |
| InChI | InChI=1S/C11H11NO2/c1-7(2)12-10(13)8-5-3-4-6-9(8)11(12)14/h3-7H,1-2H3 |
| InChIKey | VPLDXHDOGVIETL-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC=C2)C(=O)N1C(C)C |
| CAS DataBase Reference | 304-17-6(CAS DataBase Reference) |
| EPA Substance Registry System | 1H-Isoindole-1,3(2H)-dione, 2-(1-methylethyl)- (304-17-6) |
