3,5-Dichloro-2-cyanopyridine
- Product Name3,5-Dichloro-2-cyanopyridine
- CAS85331-33-5
- MFC6H2Cl2N2
- MW173
- EINECS674-558-4
- MOL File85331-33-5.mol
Chemical Properties
| Melting point | 101-103°C |
| Boiling point | 271.9±35.0 °C(Predicted) |
| Density | 1.49±0.1 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | -4.61±0.10(Predicted) |
| color | White to Light yellow |
| BRN | 4390101 |
| InChI | InChI=1S/C6H2Cl2N2/c7-4-1-5(8)6(2-9)10-3-4/h1,3H |
| InChIKey | ATUOLSDAAPMVJJ-UHFFFAOYSA-N |
| SMILES | C1(C#N)=NC=C(Cl)C=C1Cl |
| CAS DataBase Reference | 85331-33-5(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi,Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37/39-36-36/37 |
| RIDADR | 3439 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 2933399990 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |