(S)-4-Methylbezenesulfinamide
- Product Name(S)-4-Methylbezenesulfinamide
- CAS188447-91-8
- MFC7H9NOS
- MW155.22
- EINECS
- MOL File188447-91-8.mol
Chemical Properties
| Melting point | 118-121 °C(lit.) |
| Boiling point | 0°C |
| Density | 1.28±0.1 g/cm3(Predicted) |
| Flash point | 0°C |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| pka | 9.52±0.40(Predicted) |
| color | White to Light yellow to Light orange |
| optical activity | [α]22/D +85°, c = 1 in chloroform |
| InChI | InChI=1/C7H9NOS/c1-6-2-4-7(5-3-6)10(8)9/h2-5H,8H2,1H3/t10-/s3 |
| InChIKey | YNJDSRPIGAUCEE-JQHDBZEONA-N |
| SMILES | C1([S@@](N)=O)=CC=C(C)C=C1 |&1:1,r| |
| CAS DataBase Reference | 188447-91-8(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HS Code | 2930909899 |
| Storage Class | 11 - Combustible Solids |
