1,3-Diphenylacetone p-toluenesulfonylhydrazone
- Product Name1,3-Diphenylacetone p-toluenesulfonylhydrazone
- CAS19816-88-7
- MFC22H22N2O2S
- MW378.49
- EINECS243-344-9
- MOL File19816-88-7.mol
Chemical Properties
| Melting point | 186-187 °C |
| Boiling point | 555.2±60.0 °C(Predicted) |
| Density | 1.1430 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | chloroform: 25mg/mL, clear, orange |
| pka | 10.29±0.40(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 2225293 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C22H22N2O2S/c1-18-12-14-22(15-13-18)27(25,26)24-23-21(16-19-8-4-2-5-9-19)17-20-10-6-3-7-11-20/h2-15,24H,16-17H2,1H3 |
| InChIKey | GDXUEUWCUUAZFM-UHFFFAOYSA-N |
| SMILES | Cc1ccc(cc1)S(=O)(=O)N\N=C(\Cc2ccccc2)Cc3ccccc3 |
| CAS DataBase Reference | 19816-88-7(CAS DataBase Reference) |
Safety Information
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 2928.00.5000 |
| Storage Class | 11 - Combustible Solids |