1,8-Dinitronaphthalene
- Product Name1,8-Dinitronaphthalene
- CAS602-38-0
- MFC10H6N2O4
- MW218.17
- EINECS210-016-1
- MOL File602-38-0.mol
Chemical Properties
| Melting point | 161 °C |
| Boiling point | 358.84°C (rough estimate) |
| Density | 1.4330 (rough estimate) |
| refractive index | 1.7040 (estimate) |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | Pale Yellow to Light Yellow |
| Water Solubility | 34mg/L(15 ºC) |
| Henry's Law Constant | 5.2×103 mol/(m3Pa) at 25℃, Parnis et al. (2015) |
| Stability | Stability Shock and heat sensitive - may react violently if heated or ground. Combustible. Incompatible with strong oxidizing agents. |
| InChI | 1S/C10H6N2O4/c13-11(14)8-5-1-3-7-4-2-6-9(10(7)8)12(15)16/h1-6H |
| InChIKey | AVCSMMMOCOTIHF-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1cccc2cccc([N+]([O-])=O)c12 |
| CAS DataBase Reference | 602-38-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Naphthalene, 1,8-dinitro-(602-38-0) |
| EPA Substance Registry System | 1,8-Dinitronaphthalene (602-38-0) |
Safety Information
| Hazard Codes | F,Xi |
| Risk Statements | 11-36/37/38 |
| Safety Statements | 16-26-36 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | QJ4552000 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Eye Irrit. 2 Flam. Sol. 2 Skin Irrit. 2 STOT SE 3 |