| Melting point |
153-155 °C(lit.) |
| Boiling point |
220.6°C (rough estimate) |
| Density |
1.5428 (rough estimate) |
| refractive index |
1.6000 (estimate) |
| storage temp. |
2-8°C(protect from light) |
| solubility |
very faint turbidity in hot Water |
| form |
powder to crystal |
| pka |
3.53±0.50(Predicted) |
| color |
White to Almost white |
| Water Solubility |
14g/L at 25℃ |
| Stability |
Light sensitive |
| InChI |
InChI=1S/C2H6N4O2/c1-4-2(3)5-6(7)8/h1H3,(H3,3,4,5) |
| InChIKey |
XCXKNNGWSDYMMS-UHFFFAOYSA-N |
| SMILES |
N(C)C(=N)N[N+]([O-])=O |
| CAS DataBase Reference |
4245-76-5(CAS DataBase Reference) |
| NIST Chemistry Reference |
N-Methyl-N'-nitroguanidine(4245-76-5) |
| EPA Substance Registry System |
Guanidine, N-methyl-N'-nitro- (4245-76-5) |
