| Melting point |
257 °C (dec.)(lit.) |
| alpha |
23.5 º (c=4, 2N HCl 24 ºC) |
| Boiling point |
360°C (rough estimate) |
| Density |
1.4177 (rough estimate) |
| refractive index |
1.8000 (estimate) |
| RTECS |
RM2982100 |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| solubility |
DMF: <50 μg/ml; DMSO: <50 μg/ml; Ethanol: <50 μg/ml; PBS pH 7.2: 1 mg/ml |
| pka |
2.49±0.24(Predicted) |
| form |
powder to crystal |
| color |
White to Almost white |
| biological source |
synthetic |
| Water Solubility |
Soluble to 5 mM in water |
| BRN |
1728914 |
| InChI |
1S/C6H13N5O4/c7-4(5(12)13)2-1-3-9-6(8)10-11(14)15/h4H,1-3,7H2,(H,12,13)(H3,8,9,10)/t4-/m0/s1 |
| InChIKey |
MRAUNPAHJZDYCK-BYPYZUCNSA-N |
| SMILES |
N[C@@H](CCCNC(=N)N[N+]([O-])=O)C(O)=O |
| CAS DataBase Reference |
2149-70-4(CAS DataBase Reference) |
| EPA Substance Registry System |
L-Ornithine, N5-[imino(nitroamino)methyl]- (2149-70-4) |
