N-(4-Aminophenyl)maleimide
- Product NameN-(4-Aminophenyl)maleimide
- CAS29753-26-2
- MFC10H8N2O2
- MW188.18
- EINECS249-824-4
- MOL File29753-26-2.mol
Chemical Properties
| Melting point | 173 °C |
| Boiling point | 401.0±28.0 °C(Predicted) |
| Density | 1.419±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C(protect from light) |
| form | powder to crystal |
| pka | 3.70±0.10(Predicted) |
| color | Light yellow to Brown |
| InChI | InChI=1S/C10H8N2O2/c11-7-1-3-8(4-2-7)12-9(13)5-6-10(12)14/h1-6H,11H2 |
| InChIKey | XOPCHXSYQHXLHJ-UHFFFAOYSA-N |
| SMILES | N1(C2=CC=C(N)C=C2)C(=O)C=CC1=O |
| CAS DataBase Reference | 29753-26-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22 |
| WGK Germany | WGK 3 |
| HS Code | 2925199590 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 4 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
