2-Chloro-5-(trifluoromethyl)benzonitrile
- Product Name2-Chloro-5-(trifluoromethyl)benzonitrile
- CAS328-87-0
- MFC8H3ClF3N
- MW205.56
- EINECS206-338-7
- MOL File328-87-0.mol
Chemical Properties
| Melting point | 38-42 °C(lit.) |
| Boiling point | 210-212 °C(lit.) |
| Density | 1.481 g/mL at 25 °C(lit.) |
| Flash point | 215 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Gray to Brown |
| BRN | 1912184 |
| InChI | InChI=1S/C8H3ClF3N/c9-7-2-1-6(8(10,11)12)3-5(7)4-13/h1-3H |
| InChIKey | LCISFYAQKHOWBP-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC(C(F)(F)F)=CC=C1Cl |
| CAS DataBase Reference | 328-87-0(CAS DataBase Reference) |
| EPA Substance Registry System | Benzonitrile, 2-chloro-5-(trifluoromethyl)- (328-87-0) |
Safety Information
| Hazard Codes | Xi,T,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-36/37/39-22 |
| RIDADR | 3276 |
| WGK Germany | 3 |
| Hazard Note | Toxic |
| TSCA | TSCA listed |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
