1,3-Propylenediaminetertaacetic acid
- Product Name1,3-Propylenediaminetertaacetic acid
- CAS1939-36-2
- MFC11H18N2O8
- MW306.27
- EINECS400-400-9
- MOL File1939-36-2.mol
Chemical Properties
| Melting point | ~250 °C (dec.) |
| Boiling point | 620.5±55.0 °C(Predicted) |
| Density | 1.507±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| Water Solubility | Soluble in water |
| form | powder to crystal |
| pka | 1.45±0.10(Predicted) |
| color | White to Almost white |
| BRN | 1716449 |
| InChI | InChI=1S/C11H18N2O8/c14-8(15)4-12(5-9(16)17)2-1-3-13(6-10(18)19)7-11(20)21/h1-7H2,(H,14,15)(H,16,17)(H,18,19)(H,20,21) |
| InChIKey | DMQQXDPCRUGSQB-UHFFFAOYSA-N |
| SMILES | C(N(CC(O)=O)CC(O)=O)CCN(CC(O)=O)CC(O)=O |
| CAS DataBase Reference | 1939-36-2(CAS DataBase Reference) |
| EPA Substance Registry System | Trimethylenediaminetetraacetic acid (1939-36-2) |
Safety Information
| Hazard Codes | Xn,N |
| Risk Statements | 22-41-50/53-62-63 |
| Safety Statements | 22-26-39-60-61-36/37 |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | 2 |
| RTECS | MC1082500 |
| TSCA | TSCA listed |
| HS Code | 2922.49.8000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Repr. 2 |