1,6-Diaminohexane-N,N,N',N'-tetraacetic acid
- Product Name1,6-Diaminohexane-N,N,N',N'-tetraacetic acid
- CAS1633-00-7
- MFC14H24N2O8
- MW348.35
- EINECS216-642-1
- MOL File1633-00-7.mol
Chemical Properties
| Melting point | 232-236 °C (dec.)(lit.) |
| Boiling point | 482.73°C (rough estimate) |
| Density | 1.2294 (rough estimate) |
| refractive index | 1.4590 (estimate) |
| solubility | almost transparency in 1mol/L NaOH |
| form | powder to crystal |
| pka | 1.55±0.10(Predicted) |
| color | White to Almost white |
| BRN | 1716834 |
| InChI | 1S/C14H24N2O8/c17-11(18)7-15(8-12(19)20)5-3-1-2-4-6-16(9-13(21)22)10-14(23)24/h1-10H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | YGDVXSDNEFDTGV-UHFFFAOYSA-N |
| SMILES | OC(=O)CN(CCCCCCN(CC(O)=O)CC(O)=O)CC(O)=O |
| CAS DataBase Reference | 1633-00-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 2922.49.8000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |