4,5-Diphenyl-2-mercaptooxazole
- Product Name4,5-Diphenyl-2-mercaptooxazole
- CAS6670-13-9
- MFC15H11NOS
- MW253.32
- EINECS229-707-4
- MOL File6670-13-9.mol
Chemical Properties
| Melting point | 254-257 °C(lit.) |
| Boiling point | 390.6±52.0 °C(Predicted) |
| Density | 1.1949 (rough estimate) |
| refractive index | 1.7500 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| pka | 8.15±0.60(Predicted) |
| color | White to Light yellow |
| Sensitive | Air Sensitive |
| InChI | 1S/C15H11NOS/c18-15-16-13(11-7-3-1-4-8-11)14(17-15)12-9-5-2-6-10-12/h1-10H,(H,16,18) |
| InChIKey | NYQSTRUSYDZNHC-UHFFFAOYSA-N |
| SMILES | Sc1nc(-c2ccccc2)c(o1)-c3ccccc3 |
| CAS DataBase Reference | 6670-13-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 36 |
| RIDADR | UN 3335 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2934999090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
