Chemical Properties
| Melting point | 227-228℃ |
| Boiling point | 609.5±55.0 °C(Predicted) |
| Density | 1.63±0.1 g/cm3 (20 ºC 760 Torr) |
| storage temp. | -20°C |
| pka | 12.01±0.70(Predicted) |
| form | Solid |
| color | White to off-white |
| Major Application | food and beverages |
| InChI | 1S/C15H20O8/c1-6-3-7(16)15(21)13(6)4-8(23-10(18)9(13)17)12(2,20)14(15)5-22-11(14)19/h6-9,16-17,20-21H,3-5H2,1-2H3/t6-,7-,8-,9+,12+,13+,14+,15-/m1/s1 |
| InChIKey | GEVWHIDSUOMVRI-QWNPAUMXSA-N |
| SMILES | O1[C@H]2[C@@]([C@]3([C@@]4([C@@]([C@@H](C[C@H]4O)C)([C@H](C1=O)O)C2)O)COC3=O)(O)C |
| LogP | -0.930 (est) |
Safety Information
| Hazard Codes | T+ |
| Risk Statements | 26/28 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2811 6.1 / PGII |
| WGK Germany | 3 |
| RTECS | WH1314700 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Inhalation Acute Tox. 2 Oral |
| Toxicity | LDLo orl-mus: 1 mg/kg CPBTAL 44,1908,1996 |