Bis(cyclopentadienyl)cobalt
- Product NameBis(cyclopentadienyl)cobalt
- CAS1277-43-6
- MFC10H10Co10*
- MW189.12
- EINECS215-061-0
- MOL File1277-43-6.mol
Chemical Properties
| Melting point | 176-180 °C (dec.)(lit.) |
| Boiling point | 173℃ [CRC10] |
| storage temp. | 2-8°C |
| form | crystal |
| color | purplish-black |
| Water Solubility | Insoluble in water. |
| Sensitive | Air & Moisture Sensitive |
| Stability | Stable, but very reactive and air and moisture sensitive - store under inert gas. Incompatible with strong oxidizing agents. Highly flammable. |
| InChI | InChI=1S/2C5H5.Co/c2*1-2-4-5-3-1;/h2*1-5H; |
| InChIKey | PXFGMRZPRDJDEK-UHFFFAOYSA-N |
| SMILES | [CH]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Co] |^1:0,1,2,3,4,5,6,7,8,9| |
| CAS DataBase Reference | 1277-43-6(CAS DataBase Reference) |
| EPA Substance Registry System | Cobaltocene (1277-43-6) |
Safety Information
| Hazard Codes | F,Xn |
| Risk Statements | 11-68-42/43-40 |
| Safety Statements | 16-33-7/9-36/37-22 |
| RIDADR | UN 1325 4.1/PG 3 |
| WGK Germany | 3 |
| RTECS | GG0350000 |
| TSCA | TSCA listed |
| HazardClass | 4.1 |
| PackingGroup | II |
| HS Code | 29319090 |
| Storage Class | 4.1B - Flammable solid hazardous materials |
| Hazard Classifications | Carc. 2 Flam. Sol. 2 Muta. 2 Resp. Sens. 1 Skin Sens. 1 |
| Toxicity | mmo-sat 3333 mg/plate EMMUEG 19(Suppl 21),2,92 |
