Cyclopentadienyltitanium trichloride
- Product NameCyclopentadienyltitanium trichloride
- CAS1270-98-0
- MFC5H5Cl3Ti5*
- MW219.32
- EINECS
- MOL File1270-98-0.mol
Chemical Properties
| Melting point | 210 °C (dec.) (lit.) |
| refractive index | 1.47 |
| storage temp. | 2-8°C, protect from light, stored under nitrogen |
| form | Crystalline |
| color | Yellow-orange |
| Water Solubility | Reacts with water. |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| InChI | 1S/C5H5.3ClH.Ti/c1-2-4-5-3-1;;;;/h1-5H;3*1H;/q;;;;+3/p-3 |
| InChIKey | AENCLWKVWIIOQH-UHFFFAOYSA-K |
| SMILES | Cl[Ti](Cl)Cl.[CH]1[CH][CH][CH][CH]1 |
| CAS DataBase Reference | 1270-98-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-28-36/37/39-45 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| RTECS | XR1927300 |
| F | 10-21 |
| TSCA | No |
| HazardClass | 8 |
| PackingGroup | II |
| HS Code | 29310099 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Eye Dam. 1 Skin Corr. 1B |
| Toxicity | mouse,LD50,parenteral,130mg/kg (130mg/kg),European Journal of Medicinal Chemistry--Chimie Therapeutique. Vol. 19, Pg. 347, 1984. |
