2,5-Dimethyl-3-furoic acid
- Product Name2,5-Dimethyl-3-furoic acid
- CAS636-44-2
- MFC7H8O3
- MW140.14
- EINECS211-257-5
- MOL File636-44-2.mol
Chemical Properties
| Melting point | 137-140 °C (lit.) |
| Boiling point | 240.6±35.0 °C(Predicted) |
| Density | 1.194±0.06 g/cm3(Predicted) |
| storage temp. | Storage temp. 2-8°C |
| pka | 4.56±0.26(Predicted) |
| form | powder to crystaline |
| color | White to Orange to Green |
| InChI | InChI=1S/C7H8O3/c1-4-3-6(7(8)9)5(2)10-4/h3H,1-2H3,(H,8,9) |
| InChIKey | CNTHHNPBADVTRY-UHFFFAOYSA-N |
| SMILES | O1C(C)=CC(C(O)=O)=C1C |
| CAS DataBase Reference | 636-44-2(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 3261 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29321900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |