1,4-Amino-N,N-dimethylaniline,dihydrochloride
- Product Name1,4-Amino-N,N-dimethylaniline,dihydrochloride
- CAS536-46-9
- MFC8H13ClN2
- MW172.66
- EINECS208-635-7
- MOL File536-46-9.mol
Chemical Properties
| Melting point | 222 °C (dec.)(lit.) |
| bulk density | 500kg/m3 |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | 2000g/l |
| form | Powder |
| color | White to beige to gray |
| PH | 1.6 (50g/l, H2O, 20℃) |
| Water Solubility | Soluble in water |
| Merck | 14,3254 |
| BRN | 3913463 |
| Major Application | food and beverages || microbiology |
| InChI | InChI=1S/C8H12N2.2ClH/c1-10(2)8-5-3-7(9)4-6-8;;/h3-6H,9H2,1-2H3;2*1H |
| InChIKey | IAEDWDXMFDKWFU-UHFFFAOYSA-N |
| SMILES | N(C1C=CC(N)=CC=1)(C)C.Cl.Cl |
| CAS DataBase Reference | 536-46-9(CAS DataBase Reference) |
| EPA Substance Registry System | 1,4-Benzenediamine, N,N-dimethyl-, dihydrochloride (536-46-9) |
Safety Information
| Hazard Codes | T |
| Risk Statements | 23/24/25-43 |
| Safety Statements | 36/37-45 |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | ST1750000 |
| F | 3-8-9 |
| TSCA | TSCA listed |
| HS Code | 2921 51 90 |
| HazardClass | 6.1 |
| PackingGroup | III |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral |