| Melting point |
152.6 °C |
| Boiling point |
432.4°C (rough estimate) |
| Density |
1.1611 (rough estimate) |
| refractive index |
1.6280 (estimate) |
| storage temp. |
Sealed in dry,2-8°C |
| solubility |
Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form |
Powder |
| pka |
3.73±0.10(Predicted) |
| Appearance |
White to off-white Solid |
| optical activity |
Consistent with structure |
| BRN |
9339089 |
| Major Application |
peptide synthesis |
| InChI |
1S/C15H18N2O4/c1-15(2,3)21-14(20)17-12(13(18)19)8-10-4-6-11(9-16)7-5-10/h4-7,12H,8H2,1-3H3,(H,17,20)(H,18,19)/t12-/m1/s1 |
| InChIKey |
RMBLTLXJGNILPG-GFCCVEGCSA-N |
| SMILES |
CC(C)(C)OC(=O)N[C@H](Cc1ccc(cc1)C#N)C(O)=O |
| CAS DataBase Reference |
146727-62-0(CAS DataBase Reference) |
