BOC-D-3,4-Dichlorophe
- Product NameBOC-D-3,4-Dichlorophe
- CAS114873-13-1
- MFC14H17Cl2NO4
- MW334.2
- EINECS
- MOL File114873-13-1.mol
Chemical Properties
| Melting point | 120°C |
| alpha | -15 º (c=1,MeOH) |
| Boiling point | 478.1±45.0 °C(Predicted) |
| Density | 1.3859 (rough estimate) |
| refractive index | 1.6200 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 3.75±0.10(Predicted) |
| form | Solid |
| color | White to off-white |
| optical activity | Consistent with structure |
| BRN | 8428163 |
| Major Application | peptide synthesis |
| InChI | 1S/C14H17Cl2NO4/c1-14(2,3)21-13(20)17-11(12(18)19)7-8-4-5-9(15)10(16)6-8/h4-6,11H,7H2,1-3H3,(H,17,20)(H,18,19)/t11-/m1/s1 |
| InChIKey | UGZIQCCPEDCGGN-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](Cc1ccc(Cl)c(Cl)c1)C(O)=O |
| CAS DataBase Reference | 114873-13-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |
