| Melting point |
246-250 °C(lit.) |
| storage temp. |
-20°C |
| solubility |
Water (Slightly) |
| form |
Crystalline Powder |
| color |
Pale yellow to yellow |
| Water Solubility |
water: 50mg/mL, clear, colorless to very faintly greenish-yellow (to Very Light Yellow) |
| BRN |
3786392 |
| InChI |
InChI=1S/C6H5NO6S.K/c8-7(9)5-1-3-6(4-2-5)13-14(10,11)12;/h1-4H,(H,10,11,12);/q;+1/p-1 |
| InChIKey |
BITVAZYUWRLLCN-UHFFFAOYSA-M |
| SMILES |
S([O-])(=O)(=O)OC1C=CC([N+]([O-])=O)=CC=1.[K+] |
| CAS DataBase Reference |
6217-68-1(CAS DataBase Reference) |
| EPA Substance Registry System |
Sulfuric acid, mono(4-nitrophenyl) ester, potassium salt (6217-68-1) |
