WORTMANNIN
- Product NameWORTMANNIN
- CAS19545-26-7
- MFC23H24O8
- MW428.43
- EINECS606-337-5
- MOL File19545-26-7.mol
Chemical Properties
| Melting point | 234-240 °C |
| alpha | +80.0~+105.0゜(20℃/D)(c=0.1,C2H5OH) |
| Boiling point | 463.31°C (rough estimate) |
| Density | 1.2454 (rough estimate) |
| refractive index | 1.4480 (estimate) |
| Flash point | 2℃ |
| storage temp. | -20°C |
| solubility | DMSO: soluble |
| form | powder |
| color | off-white |
| biological source | Penicillium funiculosum |
| Sensitive | Light Sensitive |
| λmax | 296nm(lit.) |
| Merck | 14,10053 |
| BRN | 67676 |
| Stability | Stable for 1 year from date of purchase as supplied. Dried aliquots evaporated from ethanol may be stored at -20° for several months. Solutions however are not stable and must be used within one working day. Note |
| InChIKey | QDLHCMPXEPAAMD-QAIWCSMKSA-N |
| SMILES | [o]1c2c3c(c1)C(=O)O[C@@H]([C@@]3(C4=C([C@H]5[C@](C[C@H]4OC(=O)C)(C(=O)CC5)C)C2=O)C)COC |
Safety Information
| Hazard Codes | T+,T,Xi,Xn,F |
| Risk Statements | 26/27/28-36/37/38-36-20/21/22-11 |
| Safety Statements | 28-36/37-45-37/39-26-16 |
| RIDADR | UN 3462 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | CB9641000 |
| F | 3-8-10 |
| HazardClass | 6.1 |
| PackingGroup | I |
| HS Code | 29322090 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Inhalation Acute Tox. 1 Oral Acute Tox. 2 Dermal |